C24H35N3O4 — CID 176689408
N-[3-(2,6-dioxopiperidin-3-yl)phenyl]-N',N'-di(propan-2-yl)heptanediamide (PubChem CID 176689408) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is N-[3-(2,6-dioxopiperidin-3-yl)phenyl]-N',N'-di(propan-2-yl)heptanediamide.
| Compound Name | N-[3-(2,6-dioxopiperidin-3-yl)phenyl]-N',N'-di(propan-2-yl)heptanediamide |
|---|---|
| PubChem CID | 176689408 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | N-[3-(2,6-dioxopiperidin-3-yl)phenyl]-N',N'-di(propan-2-yl)heptanediamide |
| SMILES | CC(C)N(C(=O)CCCCCC(=O)Nc1cccc(C2CCC(=O)NC2=O)c1)C(C)C |
| InChI | InChI=1S/C24H35N3O4/c1-16(2)27(17(3)4)23(30)12-7-5-6-11-21(28)25-19-10-8-9-18(15-19)20-13-14-22(29)26-24(20)31/h8-10,15-17,20H,5-7,11-14H2,1-4H3,(H,25,28)(H,26,29,31) |
| InChIKey | XCJNZXXQSUEFNF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|