C26H35N3O5 — CID 176689424
N-[3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-5-yl]-N',N'-di(propan-2-yl)heptanediamide (PubChem CID 176689424) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is N-[3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-5-yl]-N',N'-di(propan-2-yl)heptanediamide.
| Compound Name | N-[3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-5-yl]-N',N'-di(propan-2-yl)heptanediamide |
|---|---|
| PubChem CID | 176689424 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | N-[3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-5-yl]-N',N'-di(propan-2-yl)heptanediamide |
| SMILES | CC(C)N(C(=O)CCCCCC(=O)Nc1ccc2occ(C3CCC(=O)NC3=O)c2c1)C(C)C |
| InChI | InChI=1S/C26H35N3O5/c1-16(2)29(17(3)4)25(32)9-7-5-6-8-23(30)27-18-10-12-22-20(14-18)21(15-34-22)19-11-13-24(31)28-26(19)33/h10,12,14-17,19H,5-9,11,13H2,1-4H3,(H,27,30)(H,28,31,33) |
| InChIKey | QFJZJAIUQAMIDR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|