C23H24N4O4 — CID 177117602
N-[1-(2,6-dioxopiperidin-3-yl)benzo[e][1]benzofuran-7-yl]-2-piperazin-1-ylacetamide (PubChem CID 177117602) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[1-(2,6-dioxopiperidin-3-yl)benzo[e][1]benzofuran-7-yl]-2-piperazin-1-ylacetamide.
| Compound Name | N-[1-(2,6-dioxopiperidin-3-yl)benzo[e][1]benzofuran-7-yl]-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 177117602 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[1-(2,6-dioxopiperidin-3-yl)benzo[e][1]benzofuran-7-yl]-2-piperazin-1-ylacetamide |
| SMILES | O=C1CCC(c2coc3ccc4cc(NC(=O)CN5CCNCC5)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C23H24N4O4/c28-20-6-4-17(23(30)26-20)18-13-31-19-5-1-14-11-15(2-3-16(14)22(18)19)25-21(29)12-27-9-7-24-8-10-27/h1-3,5,11,13,17,24H,4,6-10,12H2,(H,25,29)(H,26,28,30) |
| InChIKey | ZMJCMPSPHMCUGA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|