C19H17NO4 — CID 147536967
3-[7-(methoxymethyl)benzo[e][1]benzofuran-1-yl]piperidine-2,6-dione (PubChem CID 147536967) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-[7-(methoxymethyl)benzo[e][1]benzofuran-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-(methoxymethyl)benzo[e][1]benzofuran-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 147536967 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-[7-(methoxymethyl)benzo[e][1]benzofuran-1-yl]piperidine-2,6-dione |
| SMILES | COCc1ccc2c(ccc3occ(C4CCC(=O)NC4=O)c32)c1 |
| InChI | InChI=1S/C19H17NO4/c1-23-9-11-2-4-13-12(8-11)3-6-16-18(13)15(10-24-16)14-5-7-17(21)20-19(14)22/h2-4,6,8,10,14H,5,7,9H2,1H3,(H,20,21,22) |
| InChIKey | FODMVWJGVHQBNJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|