C19H19N3O3 — CID 167001494
(3R)-3-[7-[(dimethylamino)methyl]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione (PubChem CID 167001494) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is (3R)-3-[7-[(dimethylamino)methyl]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione.
| Compound Name | (3R)-3-[7-[(dimethylamino)methyl]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167001494 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (3R)-3-[7-[(dimethylamino)methyl]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
| SMILES | CN(C)Cc1ccc2c(ccc3onc([C@H]4CCC(=O)NC4=O)c32)c1 |
| InChI | InChI=1S/C19H19N3O3/c1-22(2)10-11-3-5-13-12(9-11)4-7-15-17(13)18(21-25-15)14-6-8-16(23)20-19(14)24/h3-5,7,9,14H,6,8,10H2,1-2H3,(H,20,23,24)/t14-/m1/s1 |
| InChIKey | YFTJKUTWMWTPGZ-CQSZACIVSA-N |
| XLogP | 2.56 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|