C14H10N2O4 — CID 164736981
(3R)-3-furo[2,3-e][1,2]benzoxazol-8-ylpiperidine-2,6-dione (PubChem CID 164736981) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is (3R)-3-furo[2,3-e][1,2]benzoxazol-8-ylpiperidine-2,6-dione.
| Compound Name | (3R)-3-furo[2,3-e][1,2]benzoxazol-8-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 164736981 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (3R)-3-furo[2,3-e][1,2]benzoxazol-8-ylpiperidine-2,6-dione |
| SMILES | O=C1CC[C@H](c2noc3ccc4ccoc4c23)C(=O)N1 |
| InChI | InChI=1S/C14H10N2O4/c17-10-4-2-8(14(18)15-10)12-11-9(20-16-12)3-1-7-5-6-19-13(7)11/h1,3,5-6,8H,2,4H2,(H,15,17,18)/t8-/m1/s1 |
| InChIKey | SZPDARPWHGUKQJ-MRVPVSSYSA-N |
| XLogP | 2.09 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|