C17H15N2O3W- — CID 165014672
3-benzo[f][1,2]benzoxazol-3-ylpiperidine-2,6-dione;carbanide;tungsten (PubChem CID 165014672) has the molecular formula C17H15N2O3W- and a molecular weight of 479.16 g/mol. Its IUPAC name is 3-benzo[f][1,2]benzoxazol-3-ylpiperidine-2,6-dione;carbanide;tungsten.
| Compound Name | 3-benzo[f][1,2]benzoxazol-3-ylpiperidine-2,6-dione;carbanide;tungsten |
|---|---|
| PubChem CID | 165014672 |
| Molecular Formula | C17H15N2O3W- |
| Molecular Weight | 479.16 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 3-benzo[f][1,2]benzoxazol-3-ylpiperidine-2,6-dione;carbanide;tungsten |
| SMILES | O=C1CCC(c2noc3cc4ccccc4cc23)C(=O)N1.[CH3-].[W] |
| InChI | InChI=1S/C16H12N2O3.CH3.W/c19-14-6-5-11(16(20)17-14)15-12-7-9-3-1-2-4-10(9)8-13(12)21-18-15;;/h1-4,7-8,11H,5-6H2,(H,17,19,20);1H3;/q;-1; |
| InChIKey | YZLGKVSYKYLEHT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|