C18H20N2O4 — CID 176741724
3-[6-[(3R)-3-(hydroxymethyl)cyclopentyl]-1,2-benzoxazol-3-yl]piperidine-2,6-dione (PubChem CID 176741724) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-[6-[(3R)-3-(hydroxymethyl)cyclopentyl]-1,2-benzoxazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(3R)-3-(hydroxymethyl)cyclopentyl]-1,2-benzoxazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176741724 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-[6-[(3R)-3-(hydroxymethyl)cyclopentyl]-1,2-benzoxazol-3-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2noc3cc(C4CC[C@@H](CO)C4)ccc23)C(=O)N1 |
| InChI | InChI=1S/C18H20N2O4/c21-9-10-1-2-11(7-10)12-3-4-13-15(8-12)24-20-17(13)14-5-6-16(22)19-18(14)23/h3-4,8,10-11,14,21H,1-2,5-7,9H2,(H,19,22,23)/t10-,11?,14?/m1/s1 |
| InChIKey | XLHQBZVECHTJRD-CDWSIMAYSA-N |
| XLogP | 2.22 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|