C13H14ClN3O3 — CID 170903448
3-[6-(aminomethyl)-1,2-benzoxazol-3-yl]piperidine-2,6-dione;hydrochloride (PubChem CID 170903448) has the molecular formula C13H14ClN3O3 and a molecular weight of 295.73 g/mol. Its IUPAC name is 3-[6-(aminomethyl)-1,2-benzoxazol-3-yl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[6-(aminomethyl)-1,2-benzoxazol-3-yl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 170903448 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 3-[6-(aminomethyl)-1,2-benzoxazol-3-yl]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.NCc1ccc2c(C3CCC(=O)NC3=O)noc2c1 |
| InChI | InChI=1S/C13H13N3O3.ClH/c14-6-7-1-2-8-10(5-7)19-16-12(8)9-3-4-11(17)15-13(9)18;/h1-2,5,9H,3-4,6,14H2,(H,15,17,18);1H |
| InChIKey | SCMRXCPPEJDJIK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|