C15H12FN3O4 — CID 170005389
3-[5-fluoro-6-(3-oxoazetidin-1-yl)-1,2-benzoxazol-3-yl]piperidine-2,6-dione (PubChem CID 170005389) has the molecular formula C15H12FN3O4 and a molecular weight of 317.28 g/mol. Its IUPAC name is 3-[5-fluoro-6-(3-oxoazetidin-1-yl)-1,2-benzoxazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-6-(3-oxoazetidin-1-yl)-1,2-benzoxazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170005389 |
| Molecular Formula | C15H12FN3O4 |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 3-[5-fluoro-6-(3-oxoazetidin-1-yl)-1,2-benzoxazol-3-yl]piperidine-2,6-dione |
| SMILES | O=C1CN(c2cc3onc(C4CCC(=O)NC4=O)c3cc2F)C1 |
| InChI | InChI=1S/C15H12FN3O4/c16-10-3-9-12(4-11(10)19-5-7(20)6-19)23-18-14(9)8-1-2-13(21)17-15(8)22/h3-4,8H,1-2,5-6H2,(H,17,21,22) |
| InChIKey | OKKPCQWOCRJYPS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|