C17H12F2N2O4 — CID 166649093
(3R)-3-[7-(difluoromethoxy)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione (PubChem CID 166649093) has the molecular formula C17H12F2N2O4 and a molecular weight of 346.29 g/mol. Its IUPAC name is (3R)-3-[7-(difluoromethoxy)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione.
| Compound Name | (3R)-3-[7-(difluoromethoxy)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166649093 |
| Molecular Formula | C17H12F2N2O4 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | (3R)-3-[7-(difluoromethoxy)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](c2noc3ccc4cc(OC(F)F)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C17H12F2N2O4/c18-17(19)24-9-2-3-10-8(7-9)1-5-12-14(10)15(21-25-12)11-4-6-13(22)20-16(11)23/h1-3,5,7,11,17H,4,6H2,(H,20,22,23)/t11-/m1/s1 |
| InChIKey | GGLMSKVLMJKSRK-LLVKDONJSA-N |
| XLogP | 3.10 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|