C22H23N3O4 — CID 167000970
(3R)-3-[7-(2-pyrrolidin-1-ylethoxy)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione (PubChem CID 167000970) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is (3R)-3-[7-(2-pyrrolidin-1-ylethoxy)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione.
| Compound Name | (3R)-3-[7-(2-pyrrolidin-1-ylethoxy)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167000970 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (3R)-3-[7-(2-pyrrolidin-1-ylethoxy)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](c2noc3ccc4cc(OCCN5CCCC5)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C22H23N3O4/c26-19-8-6-17(22(27)23-19)21-20-16-5-4-15(28-12-11-25-9-1-2-10-25)13-14(16)3-7-18(20)29-24-21/h3-5,7,13,17H,1-2,6,8-12H2,(H,23,26,27)/t17-/m1/s1 |
| InChIKey | IEIQIRXLFRQODY-QGZVFWFLSA-N |
| XLogP | 2.98 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|