C23H23N3O4 — CID 166649129
(3S)-3-[7-[2-(3-azabicyclo[3.1.0]hexan-3-yl)ethoxy]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione (PubChem CID 166649129) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is (3S)-3-[7-[2-(3-azabicyclo[3.1.0]hexan-3-yl)ethoxy]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[7-[2-(3-azabicyclo[3.1.0]hexan-3-yl)ethoxy]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166649129 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (3S)-3-[7-[2-(3-azabicyclo[3.1.0]hexan-3-yl)ethoxy]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@@H](c2noc3ccc4cc(OCCN5CC6CC6C5)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C23H23N3O4/c27-20-6-4-18(23(28)24-20)22-21-17-3-2-16(10-13(17)1-5-19(21)30-25-22)29-8-7-26-11-14-9-15(14)12-26/h1-3,5,10,14-15,18H,4,6-9,11-12H2,(H,24,27,28)/t14?,15?,18-/m0/s1 |
| InChIKey | QTKGSSGWSAFKFV-JMLCCBQJSA-N |
| XLogP | 2.83 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|