C18H17N3O7S2 — CID 167000987
N-[1-(2,6-dioxopiperidin-3-yl)benzo[e][1,2]benzoxazol-7-yl]-N-methylsulfonylmethanesulfonamide (PubChem CID 167000987) has the molecular formula C18H17N3O7S2 and a molecular weight of 451.48 g/mol. Its IUPAC name is N-[1-(2,6-dioxopiperidin-3-yl)benzo[e][1,2]benzoxazol-7-yl]-N-methylsulfonylmethanesulfonamide.
| Compound Name | N-[1-(2,6-dioxopiperidin-3-yl)benzo[e][1,2]benzoxazol-7-yl]-N-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 167000987 |
| Molecular Formula | C18H17N3O7S2 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | N-[1-(2,6-dioxopiperidin-3-yl)benzo[e][1,2]benzoxazol-7-yl]-N-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(c1ccc2c(ccc3onc(C4CCC(=O)NC4=O)c32)c1)S(C)(=O)=O |
| InChI | InChI=1S/C18H17N3O7S2/c1-29(24,25)21(30(2,26)27)11-4-5-12-10(9-11)3-7-14-16(12)17(20-28-14)13-6-8-15(22)19-18(13)23/h3-5,7,9,13H,6,8H2,1-2H3,(H,19,22,23) |
| InChIKey | ZKCGCAXOXYAHLI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|