C23H24N2O4 — CID 164995141
3-[7-(4,4-dimethylpentanoyl)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione (PubChem CID 164995141) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-[7-(4,4-dimethylpentanoyl)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-(4,4-dimethylpentanoyl)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164995141 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-[7-(4,4-dimethylpentanoyl)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)CCC(=O)c1ccc2c(ccc3onc(C4CCC(=O)NC4=O)c32)c1 |
| InChI | InChI=1S/C23H24N2O4/c1-23(2,3)11-10-17(26)14-4-6-15-13(12-14)5-8-18-20(15)21(25-29-18)16-7-9-19(27)24-22(16)28/h4-6,8,12,16H,7,9-11H2,1-3H3,(H,24,27,28) |
| InChIKey | YOQVVPCCZSQDHA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|