C22H24N4O4 — CID 166648831
3-[7-(2-piperazin-1-ylethoxy)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione (PubChem CID 166648831) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-[7-(2-piperazin-1-ylethoxy)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-(2-piperazin-1-ylethoxy)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166648831 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-[7-(2-piperazin-1-ylethoxy)benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2noc3ccc4cc(OCCN5CCNCC5)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C22H24N4O4/c27-19-6-4-17(22(28)24-19)21-20-16-3-2-15(13-14(16)1-5-18(20)30-25-21)29-12-11-26-9-7-23-8-10-26/h1-3,5,13,17,23H,4,6-12H2,(H,24,27,28) |
| InChIKey | HLQYZNPXKFFRAC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|