C29H37N3O4 — CID 166648993
3-[7-[3-methyl-6-(1-methylpiperidin-4-yl)hexoxy]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione (PubChem CID 166648993) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is 3-[7-[3-methyl-6-(1-methylpiperidin-4-yl)hexoxy]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[3-methyl-6-(1-methylpiperidin-4-yl)hexoxy]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166648993 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 3-[7-[3-methyl-6-(1-methylpiperidin-4-yl)hexoxy]benzo[e][1,2]benzoxazol-1-yl]piperidine-2,6-dione |
| SMILES | CC(CCCC1CCN(C)CC1)CCOc1ccc2c(ccc3onc(C4CCC(=O)NC4=O)c32)c1 |
| InChI | InChI=1S/C29H37N3O4/c1-19(4-3-5-20-12-15-32(2)16-13-20)14-17-35-22-7-8-23-21(18-22)6-10-25-27(23)28(31-36-25)24-9-11-26(33)30-29(24)34/h6-8,10,18-20,24H,3-5,9,11-17H2,1-2H3,(H,30,33,34) |
| InChIKey | SYUGZEUGQMMAIK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|