C23H22N2O5 — CID 165058816
(4R)-4-[7-[2-(2-oxopyrrolidin-1-yl)ethoxy]benzo[e][1,2]benzoxazol-1-yl]cyclohexane-1,3-dione (PubChem CID 165058816) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is (4R)-4-[7-[2-(2-oxopyrrolidin-1-yl)ethoxy]benzo[e][1,2]benzoxazol-1-yl]cyclohexane-1,3-dione.
| Compound Name | (4R)-4-[7-[2-(2-oxopyrrolidin-1-yl)ethoxy]benzo[e][1,2]benzoxazol-1-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 165058816 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (4R)-4-[7-[2-(2-oxopyrrolidin-1-yl)ethoxy]benzo[e][1,2]benzoxazol-1-yl]cyclohexane-1,3-dione |
| SMILES | O=C1CC[C@H](c2noc3ccc4cc(OCCN5CCCC5=O)ccc4c23)C(=O)C1 |
| InChI | InChI=1S/C23H22N2O5/c26-15-4-6-18(19(27)13-15)23-22-17-7-5-16(12-14(17)3-8-20(22)30-24-23)29-11-10-25-9-1-2-21(25)28/h3,5,7-8,12,18H,1-2,4,6,9-11,13H2/t18-/m0/s1 |
| InChIKey | KRYASTSNLJHNJG-SFHVURJKSA-N |
| XLogP | 3.39 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|