C26H30N2O4 — CID 165063320
(4S)-4-[7-[2-[cyclohexyl(methyl)amino]ethoxy]benzo[e][1,2]benzoxazol-1-yl]cyclohexane-1,3-dione (PubChem CID 165063320) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is (4S)-4-[7-[2-[cyclohexyl(methyl)amino]ethoxy]benzo[e][1,2]benzoxazol-1-yl]cyclohexane-1,3-dione.
| Compound Name | (4S)-4-[7-[2-[cyclohexyl(methyl)amino]ethoxy]benzo[e][1,2]benzoxazol-1-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 165063320 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (4S)-4-[7-[2-[cyclohexyl(methyl)amino]ethoxy]benzo[e][1,2]benzoxazol-1-yl]cyclohexane-1,3-dione |
| SMILES | CN(CCOc1ccc2c(ccc3onc([C@@H]4CCC(=O)CC4=O)c32)c1)C1CCCCC1 |
| InChI | InChI=1S/C26H30N2O4/c1-28(18-5-3-2-4-6-18)13-14-31-20-9-11-21-17(15-20)7-12-24-25(21)26(27-32-24)22-10-8-19(29)16-23(22)30/h7,9,11-12,15,18,22H,2-6,8,10,13-14,16H2,1H3/t22-/m1/s1 |
| InChIKey | LHTQSENFUMPLPQ-JOCHJYFZSA-N |
| XLogP | 5.03 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|