C26H30N2O4 — CID 158566264
(4R)-4-[7-[2-[methyl(piperidin-4-yl)amino]ethoxy]benzo[e][1]benzofuran-1-yl]cyclohexane-1,3-dione (PubChem CID 158566264) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is (4R)-4-[7-[2-[methyl(piperidin-4-yl)amino]ethoxy]benzo[e][1]benzofuran-1-yl]cyclohexane-1,3-dione.
| Compound Name | (4R)-4-[7-[2-[methyl(piperidin-4-yl)amino]ethoxy]benzo[e][1]benzofuran-1-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 158566264 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (4R)-4-[7-[2-[methyl(piperidin-4-yl)amino]ethoxy]benzo[e][1]benzofuran-1-yl]cyclohexane-1,3-dione |
| SMILES | CN(CCOc1ccc2c(ccc3occ([C@H]4CCC(=O)CC4=O)c32)c1)C1CCNCC1 |
| InChI | InChI=1S/C26H30N2O4/c1-28(18-8-10-27-11-9-18)12-13-31-20-4-6-21-17(14-20)2-7-25-26(21)23(16-32-25)22-5-3-19(29)15-24(22)30/h2,4,6-7,14,16,18,22,27H,3,5,8-13,15H2,1H3/t22-/m1/s1 |
| InChIKey | GGCUXKDTLZMQMQ-JOCHJYFZSA-N |
| XLogP | 4.05 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|