C22H23NO4 — CID 159671008
4-[7-[2-(dimethylamino)ethoxy]benzo[e][1]benzofuran-1-yl]cyclohexane-1,3-dione (PubChem CID 159671008) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[7-[2-(dimethylamino)ethoxy]benzo[e][1]benzofuran-1-yl]cyclohexane-1,3-dione.
| Compound Name | 4-[7-[2-(dimethylamino)ethoxy]benzo[e][1]benzofuran-1-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 159671008 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 4-[7-[2-(dimethylamino)ethoxy]benzo[e][1]benzofuran-1-yl]cyclohexane-1,3-dione |
| SMILES | CN(C)CCOc1ccc2c(ccc3occ(C4CCC(=O)CC4=O)c32)c1 |
| InChI | InChI=1S/C22H23NO4/c1-23(2)9-10-26-16-5-7-17-14(11-16)3-8-21-22(17)19(13-27-21)18-6-4-15(24)12-20(18)25/h3,5,7-8,11,13,18H,4,6,9-10,12H2,1-2H3 |
| InChIKey | GHSNXKAUYFSEDZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|