C17H12FNO3 — CID 164963862
(4S)-4-(7-fluorobenzo[e][1,2]benzoxazol-1-yl)cyclohexane-1,3-dione (PubChem CID 164963862) has the molecular formula C17H12FNO3 and a molecular weight of 297.28 g/mol. Its IUPAC name is (4S)-4-(7-fluorobenzo[e][1,2]benzoxazol-1-yl)cyclohexane-1,3-dione.
| Compound Name | (4S)-4-(7-fluorobenzo[e][1,2]benzoxazol-1-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 164963862 |
| Molecular Formula | C17H12FNO3 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (4S)-4-(7-fluorobenzo[e][1,2]benzoxazol-1-yl)cyclohexane-1,3-dione |
| SMILES | O=C1CC[C@@H](c2noc3ccc4cc(F)ccc4c23)C(=O)C1 |
| InChI | InChI=1S/C17H12FNO3/c18-10-2-4-12-9(7-10)1-6-15-16(12)17(19-22-15)13-5-3-11(20)8-14(13)21/h1-2,4,6-7,13H,3,5,8H2/t13-/m1/s1 |
| InChIKey | CBLIUKKBFDYODW-CYBMUJFWSA-N |
| XLogP | 3.53 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|