C13H10N4O3 — CID 164736995
3-(6H-pyrazolo[4,5-e][1,2]benzoxazol-1-yl)piperidine-2,6-dione (PubChem CID 164736995) has the molecular formula C13H10N4O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 3-(6H-pyrazolo[4,5-e][1,2]benzoxazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(6H-pyrazolo[4,5-e][1,2]benzoxazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 164736995 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 3-(6H-pyrazolo[4,5-e][1,2]benzoxazol-1-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(c2noc3ccc4[nH]ncc4c23)C(=O)N1 |
| InChI | InChI=1S/C13H10N4O3/c18-10-4-1-6(13(19)15-10)12-11-7-5-14-16-8(7)2-3-9(11)20-17-12/h2-3,5-6H,1,4H2,(H,14,16)(H,15,18,19) |
| InChIKey | JSESHMIQPNXDCH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|