About 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde
1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde (PubChem CID 177144627) has the molecular formula C19H21FN4O3
and a molecular weight of 372.40 g/mol. Its IUPAC name is 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde.
Molecular Properties
| Compound Name | 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde |
| PubChem CID | 177144627 |
| Molecular Formula | C19H21FN4O3 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cc(F)c(N3CCC(C=O)CC3)cc21 |
| InChI | InChI=1S/C19H21FN4O3/c1-23-15-9-16(24-6-4-11(10-25)5-7-24)14(20)8-13(15)18(22-23)12-2-3-17(26)21-19(12)27/h8-12H,2-7H2,1H3,(H,21,26,27) |
| InChIKey | XITDWHVYODUIQJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde?
The IUPAC name of 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde (CID 177144627) is 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde.
What is the SMILES notation for 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde?
The canonical SMILES for 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde is Cn1nc(C2CCC(=O)NC2=O)c2cc(F)c(N3CCC(C=O)CC3)cc21.
What is the InChIKey of 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde?
The InChIKey is XITDWHVYODUIQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21FN4O3/c1-23-15-9-16(24-6-4-11(10-25)5-7-24)14(20)8-13(15)18(22-23)12-2-3-17(26)21-19(12)27/h8-12H,2-7H2,1H3,(H,21,26,27).
What are the key properties of 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde?
1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde has a molecular weight of 372.40 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde is sourced from PubChem (CID 177144627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).