C19H21FN4O3 — CID 177144627
1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde (PubChem CID 177144627) has the molecular formula C19H21FN4O3 and a molecular weight of 372.40 g/mol. Its IUPAC name is 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde.
| Compound Name | 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 177144627 |
| Molecular Formula | C19H21FN4O3 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-1-methylindazol-6-yl]piperidine-4-carbaldehyde |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cc(F)c(N3CCC(C=O)CC3)cc21 |
| InChI | InChI=1S/C19H21FN4O3/c1-23-15-9-16(24-6-4-11(10-25)5-7-24)14(20)8-13(15)18(22-23)12-2-3-17(26)21-19(12)27/h8-12H,2-7H2,1H3,(H,21,26,27) |
| InChIKey | XITDWHVYODUIQJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|