C17H21N3O2 — CID 178017694
3-(1,5-dimethyl-6-propan-2-ylindazol-3-yl)piperidine-2,6-dione (PubChem CID 178017694) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-(1,5-dimethyl-6-propan-2-ylindazol-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(1,5-dimethyl-6-propan-2-ylindazol-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 178017694 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 3-(1,5-dimethyl-6-propan-2-ylindazol-3-yl)piperidine-2,6-dione |
| SMILES | Cc1cc2c(C3CCC(=O)NC3=O)nn(C)c2cc1C(C)C |
| InChI | InChI=1S/C17H21N3O2/c1-9(2)12-8-14-13(7-10(12)3)16(19-20(14)4)11-5-6-15(21)18-17(11)22/h7-9,11H,5-6H2,1-4H3,(H,18,21,22) |
| InChIKey | IUPOWKHGZPYSAP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|