C21H27FN4O2 — CID 170931692
3-[5-fluoro-1-methyl-6-(1-propan-2-ylpiperidin-4-yl)indazol-3-yl]piperidine-2,6-dione (PubChem CID 170931692) has the molecular formula C21H27FN4O2 and a molecular weight of 386.47 g/mol. Its IUPAC name is 3-[5-fluoro-1-methyl-6-(1-propan-2-ylpiperidin-4-yl)indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-1-methyl-6-(1-propan-2-ylpiperidin-4-yl)indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170931692 |
| Molecular Formula | C21H27FN4O2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 3-[5-fluoro-1-methyl-6-(1-propan-2-ylpiperidin-4-yl)indazol-3-yl]piperidine-2,6-dione |
| SMILES | CC(C)N1CCC(c2cc3c(cc2F)c(C2CCC(=O)NC2=O)nn3C)CC1 |
| InChI | InChI=1S/C21H27FN4O2/c1-12(2)26-8-6-13(7-9-26)15-11-18-16(10-17(15)22)20(24-25(18)3)14-4-5-19(27)23-21(14)28/h10-14H,4-9H2,1-3H3,(H,23,27,28) |
| InChIKey | WTOMNRISWZVPMX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|