C19H22F4N2O2 — CID 166472131
3-[4-(3,3-difluoro-1-propan-2-ylpiperidin-4-yl)-2,5-difluorophenyl]piperidine-2,6-dione (PubChem CID 166472131) has the molecular formula C19H22F4N2O2 and a molecular weight of 386.39 g/mol. Its IUPAC name is 3-[4-(3,3-difluoro-1-propan-2-ylpiperidin-4-yl)-2,5-difluorophenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-(3,3-difluoro-1-propan-2-ylpiperidin-4-yl)-2,5-difluorophenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166472131 |
| Molecular Formula | C19H22F4N2O2 |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-[4-(3,3-difluoro-1-propan-2-ylpiperidin-4-yl)-2,5-difluorophenyl]piperidine-2,6-dione |
| SMILES | CC(C)N1CCC(c2cc(F)c(C3CCC(=O)NC3=O)cc2F)C(F)(F)C1 |
| InChI | InChI=1S/C19H22F4N2O2/c1-10(2)25-6-5-14(19(22,23)9-25)13-8-15(20)12(7-16(13)21)11-3-4-17(26)24-18(11)27/h7-8,10-11,14H,3-6,9H2,1-2H3,(H,24,26,27) |
| InChIKey | ITYLSSKBONJTQR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|