C18H20F2N2O4 — CID 166472394
2-[4-[4-(2,6-dioxopiperidin-3-yl)-2,5-difluorophenyl]piperidin-1-yl]acetic acid (PubChem CID 166472394) has the molecular formula C18H20F2N2O4 and a molecular weight of 366.36 g/mol. Its IUPAC name is 2-[4-[4-(2,6-dioxopiperidin-3-yl)-2,5-difluorophenyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-(2,6-dioxopiperidin-3-yl)-2,5-difluorophenyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 166472394 |
| Molecular Formula | C18H20F2N2O4 |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-[4-[4-(2,6-dioxopiperidin-3-yl)-2,5-difluorophenyl]piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCC(c2cc(F)c(C3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C18H20F2N2O4/c19-14-8-13(11-1-2-16(23)21-18(11)26)15(20)7-12(14)10-3-5-22(6-4-10)9-17(24)25/h7-8,10-11H,1-6,9H2,(H,24,25)(H,21,23,26) |
| InChIKey | XGSWLMBABQKLLI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|