C16H18FN3O3 — CID 171774160
1-[5-[(3R)-2,6-dioxopiperidin-3-yl]-3-fluoro-2-pyridinyl]piperidine-4-carbaldehyde (PubChem CID 171774160) has the molecular formula C16H18FN3O3 and a molecular weight of 319.34 g/mol. Its IUPAC name is 1-[5-[(3R)-2,6-dioxopiperidin-3-yl]-3-fluoro-2-pyridinyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[5-[(3R)-2,6-dioxopiperidin-3-yl]-3-fluoro-2-pyridinyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 171774160 |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 1-[5-[(3R)-2,6-dioxopiperidin-3-yl]-3-fluoro-2-pyridinyl]piperidine-4-carbaldehyde |
| SMILES | O=CC1CCN(c2ncc([C@H]3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C16H18FN3O3/c17-13-7-11(12-1-2-14(22)19-16(12)23)8-18-15(13)20-5-3-10(9-21)4-6-20/h7-10,12H,1-6H2,(H,19,22,23)/t12-/m1/s1 |
| InChIKey | LCKKIXIKYMYKBL-GFCCVEGCSA-N |
| XLogP | 1.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|