C21H27FN2O3 — CID 175422737
2-tert-butyl-1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperidine-4-carbaldehyde (PubChem CID 175422737) has the molecular formula C21H27FN2O3 and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-tert-butyl-1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperidine-4-carbaldehyde.
| Compound Name | 2-tert-butyl-1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 175422737 |
| Molecular Formula | C21H27FN2O3 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-tert-butyl-1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperidine-4-carbaldehyde |
| SMILES | CC(C)(C)C1CC(C=O)CCN1c1ccc(C2CCC(=O)NC2=O)cc1F |
| InChI | InChI=1S/C21H27FN2O3/c1-21(2,3)18-10-13(12-25)8-9-24(18)17-6-4-14(11-16(17)22)15-5-7-19(26)23-20(15)27/h4,6,11-13,15,18H,5,7-10H2,1-3H3,(H,23,26,27) |
| InChIKey | UKVLFAYBQVJANO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|