C16H20FN3O3 — CID 166113598
3-[5-fluoro-6-[4-(hydroxymethyl)piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione (PubChem CID 166113598) has the molecular formula C16H20FN3O3 and a molecular weight of 321.35 g/mol. Its IUPAC name is 3-[5-fluoro-6-[4-(hydroxymethyl)piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-6-[4-(hydroxymethyl)piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166113598 |
| Molecular Formula | C16H20FN3O3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-[5-fluoro-6-[4-(hydroxymethyl)piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cnc(N3CCC(CO)CC3)c(F)c2)C(=O)N1 |
| InChI | InChI=1S/C16H20FN3O3/c17-13-7-11(12-1-2-14(22)19-16(12)23)8-18-15(13)20-5-3-10(9-21)4-6-20/h7-8,10,12,21H,1-6,9H2,(H,19,22,23) |
| InChIKey | IPOKWLJEODKRPG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|