C18H23FN4O2 — CID 166471840
3-[5-fluoro-6-(2-methyl-2,7-diazaspiro[3.5]nonan-7-yl)-3-pyridinyl]piperidine-2,6-dione (PubChem CID 166471840) has the molecular formula C18H23FN4O2 and a molecular weight of 346.41 g/mol. Its IUPAC name is 3-[5-fluoro-6-(2-methyl-2,7-diazaspiro[3.5]nonan-7-yl)-3-pyridinyl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-6-(2-methyl-2,7-diazaspiro[3.5]nonan-7-yl)-3-pyridinyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166471840 |
| Molecular Formula | C18H23FN4O2 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 3-[5-fluoro-6-(2-methyl-2,7-diazaspiro[3.5]nonan-7-yl)-3-pyridinyl]piperidine-2,6-dione |
| SMILES | CN1CC2(CCN(c3ncc(C4CCC(=O)NC4=O)cc3F)CC2)C1 |
| InChI | InChI=1S/C18H23FN4O2/c1-22-10-18(11-22)4-6-23(7-5-18)16-14(19)8-12(9-20-16)13-2-3-15(24)21-17(13)25/h8-9,13H,2-7,10-11H2,1H3,(H,21,24,25) |
| InChIKey | MFOSMANKIPHWTA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|