C11H12N2O2 — CID 167474889
3-(5-methyl-3-pyridinyl)piperidine-2,6-dione (PubChem CID 167474889) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-(5-methyl-3-pyridinyl)piperidine-2,6-dione.
| Compound Name | 3-(5-methyl-3-pyridinyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 167474889 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 3-(5-methyl-3-pyridinyl)piperidine-2,6-dione |
| SMILES | Cc1cncc(C2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C11H12N2O2/c1-7-4-8(6-12-5-7)9-2-3-10(14)13-11(9)15/h4-6,9H,2-3H2,1H3,(H,13,14,15) |
| InChIKey | TXABVEXZCCBCLF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|