C12H17N3O2 — CID 171565294
ethane;3-(5-methylpyrimidin-2-yl)piperidine-2,6-dione (PubChem CID 171565294) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is ethane;3-(5-methylpyrimidin-2-yl)piperidine-2,6-dione.
| Compound Name | ethane;3-(5-methylpyrimidin-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 171565294 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | ethane;3-(5-methylpyrimidin-2-yl)piperidine-2,6-dione |
| SMILES | CC.Cc1cnc(C2CCC(=O)NC2=O)nc1 |
| InChI | InChI=1S/C10H11N3O2.C2H6/c1-6-4-11-9(12-5-6)7-2-3-8(14)13-10(7)15;1-2/h4-5,7H,2-3H2,1H3,(H,13,14,15);1-2H3 |
| InChIKey | PCJMUGZLZLKXMR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|