C14H17N3O2 — CID 166536427
3-[1,5-bis[(Z)-prop-1-enyl]imidazol-2-yl]piperidine-2,6-dione (PubChem CID 166536427) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-[1,5-bis[(Z)-prop-1-enyl]imidazol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[1,5-bis[(Z)-prop-1-enyl]imidazol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166536427 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 3-[1,5-bis[(Z)-prop-1-enyl]imidazol-2-yl]piperidine-2,6-dione |
| SMILES | C/C=C\c1cnc(C2CCC(=O)NC2=O)n1/C=C\C |
| InChI | InChI=1S/C14H17N3O2/c1-3-5-10-9-15-13(17(10)8-4-2)11-6-7-12(18)16-14(11)19/h3-5,8-9,11H,6-7H2,1-2H3,(H,16,18,19)/b5-3-,8-4- |
| InChIKey | OJNXLXFUARLOMB-ZWWVTPAXSA-N |
| XLogP | 1.93 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|