C16H23N3O2 — CID 167470499
ethane;3-[5-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]pyrazol-3-yl]piperidine-2,6-dione (PubChem CID 167470499) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethane;3-[5-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]pyrazol-3-yl]piperidine-2,6-dione.
| Compound Name | ethane;3-[5-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]pyrazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167470499 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | ethane;3-[5-ethenyl-1-methyl-4-[(Z)-prop-1-enyl]pyrazol-3-yl]piperidine-2,6-dione |
| SMILES | C=Cc1c(/C=C\C)c(C2CCC(=O)NC2=O)nn1C.CC |
| InChI | InChI=1S/C14H17N3O2.C2H6/c1-4-6-9-11(5-2)17(3)16-13(9)10-7-8-12(18)15-14(10)19;1-2/h4-6,10H,2,7-8H2,1,3H3,(H,15,18,19);1-2H3/b6-4-; |
| InChIKey | RNCZHRFDIUBNMN-YHSAGPEESA-N |
| XLogP | 2.64 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|