C15H19N3O2 — CID 176933299
3-[(4E,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1-methylpyrazol-3-yl]piperidine-2,6-dione (PubChem CID 176933299) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-[(4E,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1-methylpyrazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[(4E,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1-methylpyrazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176933299 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-[(4E,5E)-5-[(Z)-but-2-enylidene]-4-ethylidene-1-methylpyrazol-3-yl]piperidine-2,6-dione |
| SMILES | C/C=C\C=c1/c(=C\C)c(C2CCC(=O)NC2=O)nn1C |
| InChI | InChI=1S/C15H19N3O2/c1-4-6-7-12-10(5-2)14(17-18(12)3)11-8-9-13(19)16-15(11)20/h4-7,11H,8-9H2,1-3H3,(H,16,19,20)/b6-4-,10-5+,12-7+ |
| InChIKey | QZJMJNLBOFEZJT-AHBAVFGYSA-N |
| XLogP | 0.10 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|