C16H19N3O2 — CID 175620442
3-(1,7,7-trimethylcyclohepta[c]pyrazol-3-yl)piperidine-2,6-dione (PubChem CID 175620442) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-(1,7,7-trimethylcyclohepta[c]pyrazol-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(1,7,7-trimethylcyclohepta[c]pyrazol-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 175620442 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-(1,7,7-trimethylcyclohepta[c]pyrazol-3-yl)piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2c1=CC(C)(C)C=CC=2 |
| InChI | InChI=1S/C16H19N3O2/c1-16(2)8-4-5-10-12(9-16)19(3)18-14(10)11-6-7-13(20)17-15(11)21/h4-5,8-9,11H,6-7H2,1-3H3,(H,17,20,21) |
| InChIKey | PSLBBXCBHHUWLQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|