C16H17N3O2 — CID 170024158
3-(6-methyl-1-prop-2-enylindazol-3-yl)piperidine-2,6-dione (PubChem CID 170024158) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-(6-methyl-1-prop-2-enylindazol-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-methyl-1-prop-2-enylindazol-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170024158 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 3-(6-methyl-1-prop-2-enylindazol-3-yl)piperidine-2,6-dione |
| SMILES | C=CCn1nc(C2CCC(=O)NC2=O)c2ccc(C)cc21 |
| InChI | InChI=1S/C16H17N3O2/c1-3-8-19-13-9-10(2)4-5-11(13)15(18-19)12-6-7-14(20)17-16(12)21/h3-5,9,12H,1,6-8H2,2H3,(H,17,20,21) |
| InChIKey | GUDWOOPSPPRYTP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|