C19H22F2N4O2 — CID 166549772
3-[6-(3,3-difluoropiperidin-4-yl)-1-ethylindazol-3-yl]piperidine-2,6-dione (PubChem CID 166549772) has the molecular formula C19H22F2N4O2 and a molecular weight of 376.41 g/mol. Its IUPAC name is 3-[6-(3,3-difluoropiperidin-4-yl)-1-ethylindazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(3,3-difluoropiperidin-4-yl)-1-ethylindazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166549772 |
| Molecular Formula | C19H22F2N4O2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 3-[6-(3,3-difluoropiperidin-4-yl)-1-ethylindazol-3-yl]piperidine-2,6-dione |
| SMILES | CCn1nc(C2CCC(=O)NC2=O)c2ccc(C3CCNCC3(F)F)cc21 |
| InChI | InChI=1S/C19H22F2N4O2/c1-2-25-15-9-11(14-7-8-22-10-19(14,20)21)3-4-12(15)17(24-25)13-5-6-16(26)23-18(13)27/h3-4,9,13-14,22H,2,5-8,10H2,1H3,(H,23,26,27) |
| InChIKey | YSADCWUQVQEQJL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|