C19H24N4O2S — CID 178017758
3-[1-methyl-6-(thiazocan-5-yl)indazol-3-yl]piperidine-2,6-dione (PubChem CID 178017758) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-[1-methyl-6-(thiazocan-5-yl)indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-methyl-6-(thiazocan-5-yl)indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178017758 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3-[1-methyl-6-(thiazocan-5-yl)indazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(C3CCCSNCC3)cc21 |
| InChI | InChI=1S/C19H24N4O2S/c1-23-16-11-13(12-3-2-10-26-20-9-8-12)4-5-14(16)18(22-23)15-6-7-17(24)21-19(15)25/h4-5,11-12,15,20H,2-3,6-10H2,1H3,(H,21,24,25) |
| InChIKey | ORTPZCLVXOWWPI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|