C18H22FN5O2 — CID 172587223
3-[6-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]-1-methylindazol-3-yl]piperidine-2,6-dione (PubChem CID 172587223) has the molecular formula C18H22FN5O2 and a molecular weight of 359.41 g/mol. Its IUPAC name is 3-[6-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]-1-methylindazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]-1-methylindazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172587223 |
| Molecular Formula | C18H22FN5O2 |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-[6-[[(3S,4R)-3-fluoropiperidin-4-yl]amino]-1-methylindazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(N[C@@H]3CCNC[C@@H]3F)cc21 |
| InChI | InChI=1S/C18H22FN5O2/c1-24-15-8-10(21-14-6-7-20-9-13(14)19)2-3-11(15)17(23-24)12-4-5-16(25)22-18(12)26/h2-3,8,12-14,20-21H,4-7,9H2,1H3,(H,22,25,26)/t12?,13-,14+/m0/s1 |
| InChIKey | CPEBOALAEZSARU-KFTPUPIBSA-N |
| XLogP | 1.21 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|