C23H28F3N5O4 — CID 170313758
3-[6-(5-azaspiro[3.5]nonan-8-ylamino)-1-methylindazol-3-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 170313758) has the molecular formula C23H28F3N5O4 and a molecular weight of 495.50 g/mol. Its IUPAC name is 3-[6-(5-azaspiro[3.5]nonan-8-ylamino)-1-methylindazol-3-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[6-(5-azaspiro[3.5]nonan-8-ylamino)-1-methylindazol-3-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170313758 |
| Molecular Formula | C23H28F3N5O4 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 3-[6-(5-azaspiro[3.5]nonan-8-ylamino)-1-methylindazol-3-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(NC3CCNC4(CCC4)C3)cc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H27N5O2.C2HF3O2/c1-26-17-11-13(23-14-7-10-22-21(12-14)8-2-9-21)3-4-15(17)19(25-26)16-5-6-18(27)24-20(16)28;3-2(4,5)1(6)7/h3-4,11,14,16,22-23H,2,5-10,12H2,1H3,(H,24,27,28);(H,6,7) |
| InChIKey | IQMXHBLTWLHFLB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|