C27H37N5O4 — CID 170629792
tert-butyl 8-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]-2-azaspiro[4.5]decane-2-carboxylate (PubChem CID 170629792) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is tert-butyl 8-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]-2-azaspiro[4.5]decane-2-carboxylate.
| Compound Name | tert-butyl 8-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]-2-azaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 170629792 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | tert-butyl 8-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]amino]-2-azaspiro[4.5]decane-2-carboxylate |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(NC3CCC4(CC3)CCN(C(=O)OC(C)(C)C)C4)cc21 |
| InChI | InChI=1S/C27H37N5O4/c1-26(2,3)36-25(35)32-14-13-27(16-32)11-9-17(10-12-27)28-18-5-6-19-21(15-18)31(4)30-23(19)20-7-8-22(33)29-24(20)34/h5-6,15,17,20,28H,7-14,16H2,1-4H3,(H,29,33,34) |
| InChIKey | ONIPKPBXJIWBMO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|