C23H29N5O4 — CID 170433167
8-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]amino]-2-azaspiro[4.5]decane-2-carboxylic acid (PubChem CID 170433167) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is 8-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]amino]-2-azaspiro[4.5]decane-2-carboxylic acid.
| Compound Name | 8-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]amino]-2-azaspiro[4.5]decane-2-carboxylic acid |
|---|---|
| PubChem CID | 170433167 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 8-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-7-yl]amino]-2-azaspiro[4.5]decane-2-carboxylic acid |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2cccc(NC3CCC4(CC3)CCN(C(=O)O)C4)c21 |
| InChI | InChI=1S/C23H29N5O4/c1-27-20-15(19(26-27)16-5-6-18(29)25-21(16)30)3-2-4-17(20)24-14-7-9-23(10-8-14)11-12-28(13-23)22(31)32/h2-4,14,16,24H,5-13H2,1H3,(H,31,32)(H,25,29,30) |
| InChIKey | OFFMUIYDVGQMDR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|