C24H31N5O4 — CID 178161570
tert-butyl 3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 178161570) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is tert-butyl 3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 178161570 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | tert-butyl 3-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(N3CC4CCC(C3)N4C(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C24H31N5O4/c1-24(2,3)33-23(32)29-15-5-6-16(29)13-28(12-15)14-7-8-17-19(11-14)27(4)26-21(17)18-9-10-20(30)25-22(18)31/h7-8,11,15-16,18H,5-6,9-10,12-13H2,1-4H3,(H,25,30,31) |
| InChIKey | MFRAICWVLXEMCA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|