C28H39N5O4 — CID 172589989
tert-butyl 4-[4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]piperazin-1-yl]cyclohexane-1-carboxylate (PubChem CID 172589989) has the molecular formula C28H39N5O4 and a molecular weight of 509.65 g/mol. Its IUPAC name is tert-butyl 4-[4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]piperazin-1-yl]cyclohexane-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]piperazin-1-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 172589989 |
| Molecular Formula | C28H39N5O4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | tert-butyl 4-[4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]piperazin-1-yl]cyclohexane-1-carboxylate |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(N3CCN(C4CCC(C(=O)OC(C)(C)C)CC4)CC3)cc21 |
| InChI | InChI=1S/C28H39N5O4/c1-28(2,3)37-27(36)18-5-7-19(8-6-18)32-13-15-33(16-14-32)20-9-10-21-23(17-20)31(4)30-25(21)22-11-12-24(34)29-26(22)35/h9-10,17-19,22H,5-8,11-16H2,1-4H3,(H,29,34,35) |
| InChIKey | DOVIGYHLINOLSL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|