C27H38FN5O2 — CID 175635442
3-[6-[4-(4-cyclohexylbutyl)-3-fluoropiperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione (PubChem CID 175635442) has the molecular formula C27H38FN5O2 and a molecular weight of 483.63 g/mol. Its IUPAC name is 3-[6-[4-(4-cyclohexylbutyl)-3-fluoropiperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(4-cyclohexylbutyl)-3-fluoropiperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175635442 |
| Molecular Formula | C27H38FN5O2 |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | 3-[6-[4-(4-cyclohexylbutyl)-3-fluoropiperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(N3CCN(CCCCC4CCCCC4)C(F)C3)cc21 |
| InChI | InChI=1S/C27H38FN5O2/c1-31-23-17-20(10-11-21(23)26(30-31)22-12-13-25(34)29-27(22)35)33-16-15-32(24(28)18-33)14-6-5-9-19-7-3-2-4-8-19/h10-11,17,19,22,24H,2-9,12-16,18H2,1H3,(H,29,34,35) |
| InChIKey | SJSBPOWIKCTFQT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|