C27H34N6O4 — CID 178161503
tert-butyl 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]pyrazol-4-yl]piperidine-1-carboxylate (PubChem CID 178161503) has the molecular formula C27H34N6O4 and a molecular weight of 506.61 g/mol. Its IUPAC name is tert-butyl 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]pyrazol-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]pyrazol-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178161503 |
| Molecular Formula | C27H34N6O4 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | tert-butyl 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]pyrazol-4-yl]piperidine-1-carboxylate |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(Cn3cc(C4CCN(C(=O)OC(C)(C)C)CC4)cn3)cc21 |
| InChI | InChI=1S/C27H34N6O4/c1-27(2,3)37-26(36)32-11-9-18(10-12-32)19-14-28-33(16-19)15-17-5-6-20-22(13-17)31(4)30-24(20)21-7-8-23(34)29-25(21)35/h5-6,13-14,16,18,21H,7-12,15H2,1-4H3,(H,29,34,35) |
| InChIKey | UEGYQFGTOZIJQQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|