C27H36F2N4O4 — CID 156508070
tert-butyl 2-tert-butyl-4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-3,3-difluoropiperidine-1-carboxylate (PubChem CID 156508070) has the molecular formula C27H36F2N4O4 and a molecular weight of 518.61 g/mol. Its IUPAC name is tert-butyl 2-tert-butyl-4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-3,3-difluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-tert-butyl-4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-3,3-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 156508070 |
| Molecular Formula | C27H36F2N4O4 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | tert-butyl 2-tert-butyl-4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-3,3-difluoropiperidine-1-carboxylate |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(C3CCN(C(=O)OC(C)(C)C)C(C(C)(C)C)C3(F)F)cc21 |
| InChI | InChI=1S/C27H36F2N4O4/c1-25(2,3)23-27(28,29)18(12-13-33(23)24(36)37-26(4,5)6)15-8-9-16-19(14-15)32(7)31-21(16)17-10-11-20(34)30-22(17)35/h8-9,14,17-18,23H,10-13H2,1-7H3,(H,30,34,35) |
| InChIKey | FPZNPGABBULLND-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|